C24H25N3O2 — CID 20667039
3-(benzylcarbamoylamino)-N-(4-propylphenyl)benzamide (PubChem CID 20667039) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-(benzylcarbamoylamino)-N-(4-propylphenyl)benzamide.
| Compound Name | 3-(benzylcarbamoylamino)-N-(4-propylphenyl)benzamide |
|---|---|
| PubChem CID | 20667039 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-(benzylcarbamoylamino)-N-(4-propylphenyl)benzamide |
| SMILES | CCCc1ccc(NC(=O)c2cccc(NC(=O)NCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-2-7-18-12-14-21(15-13-18)26-23(28)20-10-6-11-22(16-20)27-24(29)25-17-19-8-4-3-5-9-19/h3-6,8-16H,2,7,17H2,1H3,(H,26,28)(H2,25,27,29) |
| InChIKey | BATUDERGKFMXEC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |