C18H38OSi2 — CID 20667253
5-[(E)-but-2-enyl]-7-ethyl-2,2,10,10-tetramethyl-1-oxa-2,10-disilacycloundecane (PubChem CID 20667253) has the molecular formula C18H38OSi2 and a molecular weight of 326.67 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-7-ethyl-2,2,10,10-tetramethyl-1-oxa-2,10-disilacycloundecane.
| Compound Name | 5-[(E)-but-2-enyl]-7-ethyl-2,2,10,10-tetramethyl-1-oxa-2,10-disilacycloundecane |
|---|---|
| PubChem CID | 20667253 |
| Molecular Formula | C18H38OSi2 |
| Molecular Weight | 326.67 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 5-[(E)-but-2-enyl]-7-ethyl-2,2,10,10-tetramethyl-1-oxa-2,10-disilacycloundecane |
| SMILES | C/C=C/CC1CC[Si](C)(C)OC[Si](C)(C)CCC(CC)C1 |
| InChI | InChI=1S/C18H38OSi2/c1-7-9-10-18-12-14-21(5,6)19-16-20(3,4)13-11-17(8-2)15-18/h7,9,17-18H,8,10-16H2,1-6H3/b9-7+ |
| InChIKey | SNXUHPMIQYIYSL-VQHVLOKHSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|