About actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol
actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol (PubChem CID 20667423) has the molecular formula C11H17Ac2N5O2
and a molecular weight of 705.29 g/mol. Its IUPAC name is actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol.
Molecular Properties
| Compound Name | actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol |
| PubChem CID | 20667423 |
| Molecular Formula | C11H17Ac2N5O2 |
| Molecular Weight | 705.29 g/mol |
| Exact Mass | 705.19 |
| IUPAC Name | actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol |
| SMILES | Nc1ncc2ncn(CCCC(CO)CO)c2n1.[Ac].[Ac] |
| InChI | InChI=1S/C11H17N5O2.2Ac/c12-11-13-4-9-10(15-11)16(7-14-9)3-1-2-8(5-17)6-18;;/h4,7-8,17-18H,1-3,5-6H2,(H2,12,13,15);; |
| InChIKey | ASUYOSURCLRSKA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 705.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol?
The IUPAC name of actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol (CID 20667423) is actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol.
What is the SMILES notation for actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol?
The canonical SMILES for actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol is Nc1ncc2ncn(CCCC(CO)CO)c2n1.[Ac].[Ac].
What is the InChIKey of actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol?
The InChIKey is ASUYOSURCLRSKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O2.2Ac/c12-11-13-4-9-10(15-11)16(7-14-9)3-1-2-8(5-17)6-18;;/h4,7-8,17-18H,1-3,5-6H2,(H2,12,13,15);;.
What are the key properties of actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol?
actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol has a molecular weight of 705.29 g/mol, XLogP of -0.21, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;2-[3-(2-aminopurin-9-yl)propyl]propane-1,3-diol is sourced from PubChem (CID 20667423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).