About methylamino morpholine-4-sulfinate
methylamino morpholine-4-sulfinate (PubChem CID 20667482) has the molecular formula C5H12N2O3S
and a molecular weight of 180.23 g/mol. Its IUPAC name is methylamino morpholine-4-sulfinate.
Molecular Properties
| Compound Name | methylamino morpholine-4-sulfinate |
| PubChem CID | 20667482 |
| Molecular Formula | C5H12N2O3S |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | methylamino morpholine-4-sulfinate |
| SMILES | CNOS(=O)N1CCOCC1 |
| InChI | InChI=1S/C5H12N2O3S/c1-6-10-11(8)7-2-4-9-5-3-7/h6H,2-5H2,1H3 |
| InChIKey | DKNMJVGLNSCNKF-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylamino morpholine-4-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylamino morpholine-4-sulfinate?
The IUPAC name of methylamino morpholine-4-sulfinate (CID 20667482) is methylamino morpholine-4-sulfinate.
What is the SMILES notation for methylamino morpholine-4-sulfinate?
The canonical SMILES for methylamino morpholine-4-sulfinate is CNOS(=O)N1CCOCC1.
What is the InChIKey of methylamino morpholine-4-sulfinate?
The InChIKey is DKNMJVGLNSCNKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O3S/c1-6-10-11(8)7-2-4-9-5-3-7/h6H,2-5H2,1H3.
What are the key properties of methylamino morpholine-4-sulfinate?
methylamino morpholine-4-sulfinate has a molecular weight of 180.23 g/mol, XLogP of -0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylamino morpholine-4-sulfinate is sourced from PubChem (CID 20667482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).