About carbanide;dichloro(trimethylsilylmethylidene)ruthenium
carbanide;dichloro(trimethylsilylmethylidene)ruthenium (PubChem CID 20667836) has the molecular formula C5H13Cl2RuSi-
and a molecular weight of 273.22 g/mol. Its IUPAC name is carbanide;dichloro(trimethylsilylmethylidene)ruthenium.
Molecular Properties
| Compound Name | carbanide;dichloro(trimethylsilylmethylidene)ruthenium |
| PubChem CID | 20667836 |
| Molecular Formula | C5H13Cl2RuSi- |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 272.92 |
| IUPAC Name | carbanide;dichloro(trimethylsilylmethylidene)ruthenium |
| SMILES | C[Si](C)(C)C=[Ru](Cl)Cl.[CH3-] |
| InChI | InChI=1S/C4H10Si.CH3.2ClH.Ru/c1-5(2,3)4;;;;/h1H,2-4H3;1H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | JHIZQUQOBJSNEF-UHFFFAOYSA-L |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbanide;dichloro(trimethylsilylmethylidene)ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;dichloro(trimethylsilylmethylidene)ruthenium?
The IUPAC name of carbanide;dichloro(trimethylsilylmethylidene)ruthenium (CID 20667836) is carbanide;dichloro(trimethylsilylmethylidene)ruthenium.
What is the SMILES notation for carbanide;dichloro(trimethylsilylmethylidene)ruthenium?
The canonical SMILES for carbanide;dichloro(trimethylsilylmethylidene)ruthenium is C[Si](C)(C)C=[Ru](Cl)Cl.[CH3-].
What is the InChIKey of carbanide;dichloro(trimethylsilylmethylidene)ruthenium?
The InChIKey is JHIZQUQOBJSNEF-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H10Si.CH3.2ClH.Ru/c1-5(2,3)4;;;;/h1H,2-4H3;1H3;2*1H;/q;-1;;;+2/p-2.
What are the key properties of carbanide;dichloro(trimethylsilylmethylidene)ruthenium?
carbanide;dichloro(trimethylsilylmethylidene)ruthenium has a molecular weight of 273.22 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;dichloro(trimethylsilylmethylidene)ruthenium is sourced from PubChem (CID 20667836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).