C22H25NO2 — CID 20667893
2-methylbutyl (E)-3-[4-[(4-methylphenyl)methylideneamino]phenyl]prop-2-enoate (PubChem CID 20667893) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-methylbutyl (E)-3-[4-[(4-methylphenyl)methylideneamino]phenyl]prop-2-enoate.
| Compound Name | 2-methylbutyl (E)-3-[4-[(4-methylphenyl)methylideneamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 20667893 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-methylbutyl (E)-3-[4-[(4-methylphenyl)methylideneamino]phenyl]prop-2-enoate |
| SMILES | CCC(C)COC(=O)/C=C/c1ccc(/N=C/c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H25NO2/c1-4-17(2)16-25-22(24)14-11-19-9-12-21(13-10-19)23-15-20-7-5-18(3)6-8-20/h5-15,17H,4,16H2,1-3H3/b14-11+,23-15+ |
| InChIKey | SDJYZLWXBFDJBV-MXHDTTNDSA-N |
| XLogP | 5.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|