About 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole
2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole (PubChem CID 20668093) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole |
| PubChem CID | 20668093 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole |
| SMILES | C=c1c(C)nn2cccc12 |
| InChI | InChI=1S/C8H8N2/c1-6-7(2)9-10-5-3-4-8(6)10/h3-5H,1H2,2H3 |
| InChIKey | AXOXSYBASHGKMP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole?
The IUPAC name of 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole (CID 20668093) is 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole.
What is the SMILES notation for 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole?
The canonical SMILES for 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole is C=c1c(C)nn2cccc12.
What is the InChIKey of 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole?
The InChIKey is AXOXSYBASHGKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-6-7(2)9-10-5-3-4-8(6)10/h3-5H,1H2,2H3.
What are the key properties of 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole?
2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole has a molecular weight of 132.17 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-methylidenepyrrolo[1,2-b]pyrazole is sourced from PubChem (CID 20668093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).