About N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide
N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide (PubChem CID 20668506) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide.
Molecular Properties
| Compound Name | N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide |
| PubChem CID | 20668506 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide |
| SMILES | [H]/N=C(\C)N(C)Cc1[nH]c(=O)[nH]c(=O)c1C |
| InChI | InChI=1S/C9H14N4O2/c1-5-7(4-13(3)6(2)10)11-9(15)12-8(5)14/h10H,4H2,1-3H3,(H2,11,12,14,15)/b10-6+ |
| InChIKey | UOSINQFCCLZYNJ-UXBLZVDNSA-N |
| XLogP | -0.20 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide?
The IUPAC name of N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide (CID 20668506) is N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide.
What is the SMILES notation for N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide?
The canonical SMILES for N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide is [H]/N=C(\C)N(C)Cc1[nH]c(=O)[nH]c(=O)c1C.
What is the InChIKey of N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide?
The InChIKey is UOSINQFCCLZYNJ-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H14N4O2/c1-5-7(4-13(3)6(2)10)11-9(15)12-8(5)14/h10H,4H2,1-3H3,(H2,11,12,14,15)/b10-6+.
What are the key properties of N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide?
N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide has a molecular weight of 210.24 g/mol, XLogP of -0.20, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]ethanimidamide is sourced from PubChem (CID 20668506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).