C20H27BrN2 — CID 20668538
4-[3-(2-bromopropan-2-yl)pyrrolidin-1-yl]-1-phenylcyclohexane-1-carbonitrile (PubChem CID 20668538) has the molecular formula C20H27BrN2 and a molecular weight of 375.35 g/mol. Its IUPAC name is 4-[3-(2-bromopropan-2-yl)pyrrolidin-1-yl]-1-phenylcyclohexane-1-carbonitrile.
| Compound Name | 4-[3-(2-bromopropan-2-yl)pyrrolidin-1-yl]-1-phenylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 20668538 |
| Molecular Formula | C20H27BrN2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-[3-(2-bromopropan-2-yl)pyrrolidin-1-yl]-1-phenylcyclohexane-1-carbonitrile |
| SMILES | CC(C)(Br)C1CCN(C2CCC(C#N)(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C20H27BrN2/c1-19(2,21)17-10-13-23(14-17)18-8-11-20(15-22,12-9-18)16-6-4-3-5-7-16/h3-7,17-18H,8-14H2,1-2H3 |
| InChIKey | LCEFOMJFACGXDD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|