C22H38O5Si — CID 20668761
methyl 2-[(2R,7S,8R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-8,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate (PubChem CID 20668761) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is methyl 2-[(2R,7S,8R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-8,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate.
| Compound Name | methyl 2-[(2R,7S,8R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-8,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 20668761 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | methyl 2-[(2R,7S,8R,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-8,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate |
| SMILES | COC(=O)C(C)(O)[C@H]1C[C@@]2(C)C(=CC1=O)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C |
| InChI | InChI=1S/C22H38O5Si/c1-14-18(27-28(8,9)20(2,3)4)11-10-15-12-17(23)16(13-21(14,15)5)22(6,25)19(24)26-7/h12,14,16,18,25H,10-11,13H2,1-9H3/t14-,16-,18-,21+,22?/m0/s1 |
| InChIKey | BXMPELQFKAXBFX-NPIBIIAASA-N |
| XLogP | 4.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|