C20H30O6 — CID 20668789
methyl 2-(1',4',8',8'a-tetramethyl-3'-oxospiro[1,3-dioxolane-2,7'-2,5,6,8-tetrahydro-1H-naphthalene]-2'-yl)-2-hydroxypropanoate (PubChem CID 20668789) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is methyl 2-(1',4',8',8'a-tetramethyl-3'-oxospiro[1,3-dioxolane-2,7'-2,5,6,8-tetrahydro-1H-naphthalene]-2'-yl)-2-hydroxypropanoate.
| Compound Name | methyl 2-(1',4',8',8'a-tetramethyl-3'-oxospiro[1,3-dioxolane-2,7'-2,5,6,8-tetrahydro-1H-naphthalene]-2'-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 20668789 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | methyl 2-(1',4',8',8'a-tetramethyl-3'-oxospiro[1,3-dioxolane-2,7'-2,5,6,8-tetrahydro-1H-naphthalene]-2'-yl)-2-hydroxypropanoate |
| SMILES | COC(=O)C(C)(O)C1C(=O)C(C)=C2CCC3(OCCO3)C(C)C2(C)C1C |
| InChI | InChI=1S/C20H30O6/c1-11-14-7-8-20(25-9-10-26-20)13(3)18(14,4)12(2)15(16(11)21)19(5,23)17(22)24-6/h12-13,15,23H,7-10H2,1-6H3 |
| InChIKey | GVIJSBGQGZFRKJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |