C38H60N14O15 — CID 20669167
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;N,N,N',N'-tetrakis[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]octane-1,8-diamine (PubChem CID 20669167) has the molecular formula C38H60N14O15 and a molecular weight of 952.98 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;N,N,N',N'-tetrakis[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]octane-1,8-diamine.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;N,N,N',N'-tetrakis[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]octane-1,8-diamine |
|---|---|
| PubChem CID | 20669167 |
| Molecular Formula | C38H60N14O15 |
| Molecular Weight | 952.98 g/mol |
| Exact Mass | 952.44 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;N,N,N',N'-tetrakis[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]octane-1,8-diamine |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCN(CCCCCCCCN(CCn1c([N+](=O)[O-])cnc1C)CCn1c([N+](=O)[O-])cnc1C)CCn1c([N+](=O)[O-])cnc1C.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C32H48N14O8.C6H12O7/c1-25-33-21-29(43(47)48)39(25)17-13-37(14-18-40-26(2)34-22-30(40)44(49)50)11-9-7-5-6-8-10-12-38(15-19-41-27(3)35-23-31(41)45(51)52)16-20-42-28(4)36-24-32(42)46(53)54;7-1-2(8)3(9)4(10)5(11)6(12)13/h21-24H,5-20H2,1-4H3;2-5,7-11H,1H2,(H,12,13)/t;2-,3-,4+,5-/m.1/s1 |
| InChIKey | KRNFRYBRKCNTBC-IFWQJVLJSA-N |
| XLogP | 0.89 |
| TPSA | 388.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.98 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|