About 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole
1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole (PubChem CID 20669177) has the molecular formula C15H24N4
and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole.
Molecular Properties
| Compound Name | 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole |
| PubChem CID | 20669177 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole |
| SMILES | Cc1cnc(C)n1CCCCCn1c(C)cnc1C |
| InChI | InChI=1S/C15H24N4/c1-12-10-16-14(3)18(12)8-6-5-7-9-19-13(2)11-17-15(19)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | SNWQMRBZWVJXFW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole?
The IUPAC name of 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole (CID 20669177) is 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole.
What is the SMILES notation for 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole?
The canonical SMILES for 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole is Cc1cnc(C)n1CCCCCn1c(C)cnc1C.
What is the InChIKey of 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole?
The InChIKey is SNWQMRBZWVJXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4/c1-12-10-16-14(3)18(12)8-6-5-7-9-19-13(2)11-17-15(19)4/h10-11H,5-9H2,1-4H3.
What are the key properties of 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole?
1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole has a molecular weight of 260.38 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,5-dimethylimidazol-1-yl)pentyl]-2,5-dimethylimidazole is sourced from PubChem (CID 20669177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).