About actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol
actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol (PubChem CID 20669248) has the molecular formula C10H12AcO2
and a molecular weight of 391.20 g/mol. Its IUPAC name is actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol.
Molecular Properties
| Compound Name | actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol |
| PubChem CID | 20669248 |
| Molecular Formula | C10H12AcO2 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol |
| SMILES | C=C(CO)c1ccc(O)cc1C.[Ac] |
| InChI | InChI=1S/C10H12O2.Ac/c1-7-5-9(12)3-4-10(7)8(2)6-11;/h3-5,11-12H,2,6H2,1H3; |
| InChIKey | CLXSVQNJKYDHLQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol?
The IUPAC name of actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol (CID 20669248) is actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol.
What is the SMILES notation for actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol?
The canonical SMILES for actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol is C=C(CO)c1ccc(O)cc1C.[Ac].
What is the InChIKey of actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol?
The InChIKey is CLXSVQNJKYDHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.Ac/c1-7-5-9(12)3-4-10(7)8(2)6-11;/h3-5,11-12H,2,6H2,1H3;.
What are the key properties of actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol?
actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol has a molecular weight of 391.20 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;4-(3-hydroxyprop-1-en-2-yl)-3-methylphenol is sourced from PubChem (CID 20669248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).