C10H9F4NO — CID 20669274
2-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)ethanamine (PubChem CID 20669274) has the molecular formula C10H9F4NO and a molecular weight of 235.18 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)ethanamine.
| Compound Name | 2-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)ethanamine |
|---|---|
| PubChem CID | 20669274 |
| Molecular Formula | C10H9F4NO |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)ethanamine |
| SMILES | NCCc1ccc2c(c1)C(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C10H9F4NO/c11-9(12)7-5-6(3-4-15)1-2-8(7)16-10(9,13)14/h1-2,5H,3-4,15H2 |
| InChIKey | QICKVSYCKJZAAD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|