About 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide
2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide (PubChem CID 20669353) has the molecular formula C17H13N3O2
and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide |
| PubChem CID | 20669353 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide |
| SMILES | [C-]#[N+]C(C(=O)Nc1ccccc1)C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C17H13N3O2/c1-18-15(17(22)19-11-7-3-2-4-8-11)14-12-9-5-6-10-13(12)16(21)20-14/h2-10,14-15H,(H,19,22)(H,20,21) |
| InChIKey | ZHXPGTKNUBRFQB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide?
The IUPAC name of 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide (CID 20669353) is 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide.
What is the SMILES notation for 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide?
The canonical SMILES for 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide is [C-]#[N+]C(C(=O)Nc1ccccc1)C1NC(=O)c2ccccc21.
What is the InChIKey of 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide?
The InChIKey is ZHXPGTKNUBRFQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O2/c1-18-15(17(22)19-11-7-3-2-4-8-11)14-12-9-5-6-10-13(12)16(21)20-14/h2-10,14-15H,(H,19,22)(H,20,21).
What are the key properties of 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide?
2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide has a molecular weight of 291.31 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyano-2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-phenylacetamide is sourced from PubChem (CID 20669353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).