About dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate
dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate (PubChem CID 20670369) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate.
Analyze dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate?
The IUPAC name of dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate (CID 20670369) is dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate.
What is the SMILES notation for dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate?
The canonical SMILES for dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate is COC(=O)C1N=C(C)C(C(=O)OC)N=C1C.
What is the InChIKey of dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate?
The InChIKey is KUQLYNHEQZATHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-5-7(9(13)15-3)12-6(2)8(11-5)10(14)16-4/h7-8H,1-4H3.
What are the key properties of dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate?
dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate has a molecular weight of 226.23 g/mol, XLogP of 0.00, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3,6-dimethyl-2,5-dihydropyrazine-2,5-dicarboxylate is sourced from PubChem (CID 20670369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).