C20H18F6N2O6S — CID 20670625
[(Z)-[2,2,2-trifluoro-1-[4-[2-[4-[(Z)-N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethoxy]phenyl]ethylidene]amino] methanesulfonate (PubChem CID 20670625) has the molecular formula C20H18F6N2O6S and a molecular weight of 528.43 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-[4-[2-[4-[(Z)-N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethoxy]phenyl]ethylidene]amino] methanesulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-[4-[2-[4-[(Z)-N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethoxy]phenyl]ethylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 20670625 |
| Molecular Formula | C20H18F6N2O6S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-[4-[2-[4-[(Z)-N-methoxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethoxy]phenyl]ethylidene]amino] methanesulfonate |
| SMILES | CO/N=C(/c1ccc(OCCOc2ccc(/C(=N/OS(C)(=O)=O)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H18F6N2O6S/c1-31-27-17(19(21,22)23)13-3-7-15(8-4-13)32-11-12-33-16-9-5-14(6-10-16)18(20(24,25)26)28-34-35(2,29)30/h3-10H,11-12H2,1-2H3/b27-17-,28-18- |
| InChIKey | DOLXZVFXBRHCQC-HJTNQMAYSA-N |
| XLogP | 4.30 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|