C33H44N2O5S — CID 20670731
2-[3-[3-(2,4-dipentylphenoxy)propylcarbamoyl]-4-hydroxy-8-(methylamino)naphthalen-1-yl]sulfanylacetic acid (PubChem CID 20670731) has the molecular formula C33H44N2O5S and a molecular weight of 580.79 g/mol. Its IUPAC name is 2-[3-[3-(2,4-dipentylphenoxy)propylcarbamoyl]-4-hydroxy-8-(methylamino)naphthalen-1-yl]sulfanylacetic acid.
| Compound Name | 2-[3-[3-(2,4-dipentylphenoxy)propylcarbamoyl]-4-hydroxy-8-(methylamino)naphthalen-1-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 20670731 |
| Molecular Formula | C33H44N2O5S |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 2-[3-[3-(2,4-dipentylphenoxy)propylcarbamoyl]-4-hydroxy-8-(methylamino)naphthalen-1-yl]sulfanylacetic acid |
| SMILES | CCCCCc1ccc(OCCCNC(=O)c2cc(SCC(=O)O)c3c(NC)cccc3c2O)c(CCCCC)c1 |
| InChI | InChI=1S/C33H44N2O5S/c1-4-6-8-12-23-16-17-28(24(20-23)13-9-7-5-2)40-19-11-18-35-33(39)26-21-29(41-22-30(36)37)31-25(32(26)38)14-10-15-27(31)34-3/h10,14-17,20-21,34,38H,4-9,11-13,18-19,22H2,1-3H3,(H,35,39)(H,36,37) |
| InChIKey | XMJAMCKURJZEND-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|