C10H21ClN2O2S — CID 20671022
1-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanesulfonamide (PubChem CID 20671022) has the molecular formula C10H21ClN2O2S and a molecular weight of 268.81 g/mol. Its IUPAC name is 1-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanesulfonamide.
| Compound Name | 1-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanesulfonamide |
|---|---|
| PubChem CID | 20671022 |
| Molecular Formula | C10H21ClN2O2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanesulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)CCl)CC(C)(C)N1 |
| InChI | InChI=1S/C10H21ClN2O2S/c1-9(2)5-8(6-10(3,4)13-9)12-16(14,15)7-11/h8,12-13H,5-7H2,1-4H3 |
| InChIKey | YWRZMGGCCSSVHW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|