C40H58O6 — CID 20671163
(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 4-[4-[[10-(2,2-dimethylpropanoyl)-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylbutanoate (PubChem CID 20671163) has the molecular formula C40H58O6 and a molecular weight of 634.90 g/mol. Its IUPAC name is (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 4-[4-[[10-(2,2-dimethylpropanoyl)-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylbutanoate.
| Compound Name | (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 4-[4-[[10-(2,2-dimethylpropanoyl)-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20671163 |
| Molecular Formula | C40H58O6 |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 634.42 |
| IUPAC Name | (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 4-[4-[[10-(2,2-dimethylpropanoyl)-5-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl]methyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylbutanoate |
| SMILES | CC1C(CC2C(=O)OC(=O)C2CCC(C)(C)C(=O)OC2(C)CC3CC2C2CCCC32)C2CC1C1C3CC(C(=O)C(C)(C)C)C(C3)C21 |
| InChI | InChI=1S/C40H58O6/c1-19-25(28-17-26(19)32-20-13-27(33(28)32)29(14-20)34(41)38(2,3)4)16-30-24(35(42)45-36(30)43)11-12-39(5,6)37(44)46-40(7)18-21-15-31(40)23-10-8-9-22(21)23/h19-33H,8-18H2,1-7H3 |
| InChIKey | YQQDNOCAQWMEEJ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|