C30H29N2O2S+ — CID 20671324
(2Z)-2-[(2E,4E)-5-(4-methylbenzo[f]quinolin-4-ium-1-yl)penta-2,4-dienylidene]-5-methylsulfinyl-3-propyl-1,3-benzoxazole (PubChem CID 20671324) has the molecular formula C30H29N2O2S+ and a molecular weight of 481.64 g/mol. Its IUPAC name is (2Z)-2-[(2E,4E)-5-(4-methylbenzo[f]quinolin-4-ium-1-yl)penta-2,4-dienylidene]-5-methylsulfinyl-3-propyl-1,3-benzoxazole.
| Compound Name | (2Z)-2-[(2E,4E)-5-(4-methylbenzo[f]quinolin-4-ium-1-yl)penta-2,4-dienylidene]-5-methylsulfinyl-3-propyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 20671324 |
| Molecular Formula | C30H29N2O2S+ |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (2Z)-2-[(2E,4E)-5-(4-methylbenzo[f]quinolin-4-ium-1-yl)penta-2,4-dienylidene]-5-methylsulfinyl-3-propyl-1,3-benzoxazole |
| SMILES | CCCN1/C(=C/C=C/C=C/c2cc[n+](C)c3ccc4ccccc4c23)Oc2ccc(S(C)=O)cc21 |
| InChI | InChI=1S/C30H29N2O2S/c1-4-19-32-27-21-24(35(3)33)15-17-28(27)34-29(32)13-7-5-6-11-23-18-20-31(2)26-16-14-22-10-8-9-12-25(22)30(23)26/h5-18,20-21H,4,19H2,1-3H3/q+1 |
| InChIKey | IJXVUIWPKIIOMS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|