C8H18O5 — CID 20671736
6-methylheptane-1,2,3,4,5-pentol (PubChem CID 20671736) has the molecular formula C8H18O5 and a molecular weight of 194.23 g/mol. Its IUPAC name is 6-methylheptane-1,2,3,4,5-pentol.
| Compound Name | 6-methylheptane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 20671736 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 6-methylheptane-1,2,3,4,5-pentol |
| SMILES | CC(C)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H18O5/c1-4(2)6(11)8(13)7(12)5(10)3-9/h4-13H,3H2,1-2H3 |
| InChIKey | VVDQVGVVCXMMBN-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |