C11H24N4O+2 — CID 20671763
N-(2-aminoethyl)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide (PubChem CID 20671763) has the molecular formula C11H24N4O+2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide.
| Compound Name | N-(2-aminoethyl)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
|---|---|
| PubChem CID | 20671763 |
| Molecular Formula | C11H24N4O+2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | N-(2-aminoethyl)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
| SMILES | C[N+]12CC[N+](CC(=O)NCCN)(CC1)CC2 |
| InChI | InChI=1S/C11H23N4O/c1-14-4-7-15(8-5-14,9-6-14)10-11(16)13-3-2-12/h2-10,12H2,1H3/q+1/p+1 |
| InChIKey | RIUCUEWLEKLHAE-UHFFFAOYSA-O |
| XLogP | -1.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|