C11H18N2S — CID 20672123
2,5,6,7-tetramethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine (PubChem CID 20672123) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 2,5,6,7-tetramethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine.
| Compound Name | 2,5,6,7-tetramethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine |
|---|---|
| PubChem CID | 20672123 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2,5,6,7-tetramethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine |
| SMILES | Cc1nc2c(s1)CC(C)N(C)C(C)C2 |
| InChI | InChI=1S/C11H18N2S/c1-7-5-10-11(14-9(3)12-10)6-8(2)13(7)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | JCMRUTZMDAJPQY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |