C13H21N3O3 — CID 20672128
methyl 2-(5,6,7-trimethyl-3-oxo-4,5,7,8-tetrahydro-1H-pyrazolo[3,4-d]azepin-2-yl)acetate (PubChem CID 20672128) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl 2-(5,6,7-trimethyl-3-oxo-4,5,7,8-tetrahydro-1H-pyrazolo[3,4-d]azepin-2-yl)acetate.
| Compound Name | methyl 2-(5,6,7-trimethyl-3-oxo-4,5,7,8-tetrahydro-1H-pyrazolo[3,4-d]azepin-2-yl)acetate |
|---|---|
| PubChem CID | 20672128 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | methyl 2-(5,6,7-trimethyl-3-oxo-4,5,7,8-tetrahydro-1H-pyrazolo[3,4-d]azepin-2-yl)acetate |
| SMILES | COC(=O)Cn1[nH]c2c(c1=O)CC(C)N(C)C(C)C2 |
| InChI | InChI=1S/C13H21N3O3/c1-8-5-10-11(6-9(2)15(8)3)14-16(13(10)18)7-12(17)19-4/h8-9,14H,5-7H2,1-4H3 |
| InChIKey | VYIVFEALSWRUNS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |