About 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid
2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid (PubChem CID 20672312) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid |
| PubChem CID | 20672312 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid |
| SMILES | O=C[C@H]1CN(c2ccccc2CC(=O)O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c21-13-16-11-20(12-17(16)14-6-2-1-3-7-14)18-9-5-4-8-15(18)10-19(22)23/h1-9,13,16-17H,10-12H2,(H,22,23)/t16-,17-/m1/s1 |
| InChIKey | HGMCZPDREBETRW-IAGOWNOFSA-N |
| XLogP | 2.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid?
The IUPAC name of 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid (CID 20672312) is 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid.
What is the SMILES notation for 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid?
The canonical SMILES for 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid is O=C[C@H]1CN(c2ccccc2CC(=O)O)C[C@@H]1c1ccccc1.
What is the InChIKey of 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid?
The InChIKey is HGMCZPDREBETRW-IAGOWNOFSA-N. The full InChI is InChI=1S/C19H19NO3/c21-13-16-11-20(12-17(16)14-6-2-1-3-7-14)18-9-5-4-8-15(18)10-19(22)23/h1-9,13,16-17H,10-12H2,(H,22,23)/t16-,17-/m1/s1.
What are the key properties of 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid?
2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid has a molecular weight of 309.37 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(3R,4S)-3-formyl-4-phenylpyrrolidin-1-yl]phenyl]acetic acid is sourced from PubChem (CID 20672312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).