C8H16NO4S- — CID 20672710
3-(2,2-dimethylpropanoylamino)propane-1-sulfonate (PubChem CID 20672710) has the molecular formula C8H16NO4S- and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoylamino)propane-1-sulfonate.
| Compound Name | 3-(2,2-dimethylpropanoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 20672710 |
| Molecular Formula | C8H16NO4S- |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-(2,2-dimethylpropanoylamino)propane-1-sulfonate |
| SMILES | CC(C)(C)C(=O)NCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H17NO4S/c1-8(2,3)7(10)9-5-4-6-14(11,12)13/h4-6H2,1-3H3,(H,9,10)(H,11,12,13)/p-1 |
| InChIKey | AWSWPLNLFDUJQW-UHFFFAOYSA-M |
| XLogP | 0.08 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|