C18H27N — CID 20672910
2-(2,6-dimethyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)-1,3,3,4,4-pentamethylpyrrolidine (PubChem CID 20672910) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)-1,3,3,4,4-pentamethylpyrrolidine.
| Compound Name | 2-(2,6-dimethyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)-1,3,3,4,4-pentamethylpyrrolidine |
|---|---|
| PubChem CID | 20672910 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2-(2,6-dimethyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)-1,3,3,4,4-pentamethylpyrrolidine |
| SMILES | C=c1cc(C)c(=C2N(C)CC(C)(C)C2(C)C)c(C)c1 |
| InChI | InChI=1S/C18H27N/c1-12-9-13(2)15(14(3)10-12)16-18(6,7)17(4,5)11-19(16)8/h9-10H,1,11H2,2-8H3 |
| InChIKey | RNIMROCXUFWNBC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |