C15H28N2O2+2 — CID 20672934
3,3,4,4,8,8,9,9-octamethyl-2,7-dimethylidene-1,6-dioxa-4,9-diazoniaspiro[4.4]nonane (PubChem CID 20672934) has the molecular formula C15H28N2O2+2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3,3,4,4,8,8,9,9-octamethyl-2,7-dimethylidene-1,6-dioxa-4,9-diazoniaspiro[4.4]nonane.
| Compound Name | 3,3,4,4,8,8,9,9-octamethyl-2,7-dimethylidene-1,6-dioxa-4,9-diazoniaspiro[4.4]nonane |
|---|---|
| PubChem CID | 20672934 |
| Molecular Formula | C15H28N2O2+2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | 3,3,4,4,8,8,9,9-octamethyl-2,7-dimethylidene-1,6-dioxa-4,9-diazoniaspiro[4.4]nonane |
| SMILES | C=C1OC2(OC(=C)C(C)(C)[N+]2(C)C)[N+](C)(C)C1(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-11-13(3,4)16(7,8)15(18-11)17(9,10)14(5,6)12(2)19-15/h1-2H2,3-10H3/q+2 |
| InChIKey | WPEOIOJELLITJQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|