About 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran
5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran (PubChem CID 20673454) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran |
| PubChem CID | 20673454 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran |
| SMILES | C=C(OC)C1=CCCSC1 |
| InChI | InChI=1S/C8H12OS/c1-7(9-2)8-4-3-5-10-6-8/h4H,1,3,5-6H2,2H3 |
| InChIKey | LNFBCHUGXRUPJC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran?
The IUPAC name of 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran (CID 20673454) is 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran.
What is the SMILES notation for 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran?
The canonical SMILES for 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran is C=C(OC)C1=CCCSC1.
What is the InChIKey of 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran?
The InChIKey is LNFBCHUGXRUPJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS/c1-7(9-2)8-4-3-5-10-6-8/h4H,1,3,5-6H2,2H3.
What are the key properties of 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran?
5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran has a molecular weight of 156.25 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methoxyethenyl)-3,6-dihydro-2H-thiopyran is sourced from PubChem (CID 20673454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).