C26H37Ac2Cl3O9 — CID 20673509
actinium;(1,4,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl) (1,1,1-trichloro-2-methylpropan-2-yl) carbonate (PubChem CID 20673509) has the molecular formula C26H37Ac2Cl3O9 and a molecular weight of 1053.93 g/mol. Its IUPAC name is actinium;(1,4,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl) (1,1,1-trichloro-2-methylpropan-2-yl) carbonate.
| Compound Name | actinium;(1,4,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl) (1,1,1-trichloro-2-methylpropan-2-yl) carbonate |
|---|---|
| PubChem CID | 20673509 |
| Molecular Formula | C26H37Ac2Cl3O9 |
| Molecular Weight | 1053.93 g/mol |
| Exact Mass | 1052.21 |
| IUPAC Name | actinium;(1,4,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl) (1,1,1-trichloro-2-methylpropan-2-yl) carbonate |
| SMILES | CC1=C2C(O)C(=O)C3(C)C(OC(=O)OC(C)(C)C(Cl)(Cl)Cl)CC4OCC4(O)C3C(C)C(O)(CC1O)C2(C)C.[Ac].[Ac] |
| InChI | InChI=1S/C26H37Cl3O9.2Ac/c1-11-13(30)9-25(35)12(2)18-23(7,19(32)17(31)16(11)21(25,3)4)14(8-15-24(18,34)10-36-15)37-20(33)38-22(5,6)26(27,28)29;;/h12-15,17-18,30-31,34-35H,8-10H2,1-7H3;; |
| InChIKey | JJEPQVUCIITRGZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.93 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|