C9H13NO6 — CID 20673614
2-[1-(2,2-dihydroxyethyl)-2,5-dioxopiperidin-4-yl]acetic acid (PubChem CID 20673614) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is 2-[1-(2,2-dihydroxyethyl)-2,5-dioxopiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(2,2-dihydroxyethyl)-2,5-dioxopiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 20673614 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-[1-(2,2-dihydroxyethyl)-2,5-dioxopiperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CC(=O)N(CC(O)O)CC1=O |
| InChI | InChI=1S/C9H13NO6/c11-6-3-10(4-9(15)16)7(12)1-5(6)2-8(13)14/h5,9,15-16H,1-4H2,(H,13,14) |
| InChIKey | CCDBTLKLJXCGIS-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|