About (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine
(2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine (PubChem CID 20673994) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine |
| PubChem CID | 20673994 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine |
| SMILES | CN(C)C/C=N/CN(C)C |
| InChI | InChI=1S/C7H17N3/c1-9(2)6-5-8-7-10(3)4/h5H,6-7H2,1-4H3/b8-5+ |
| InChIKey | YVGGVMMXPBNLAS-VMPITWQZSA-N |
| XLogP | 0.14 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine?
The IUPAC name of (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine (CID 20673994) is (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine.
What is the SMILES notation for (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine?
The canonical SMILES for (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine is CN(C)C/C=N/CN(C)C.
What is the InChIKey of (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine?
The InChIKey is YVGGVMMXPBNLAS-VMPITWQZSA-N. The full InChI is InChI=1S/C7H17N3/c1-9(2)6-5-8-7-10(3)4/h5H,6-7H2,1-4H3/b8-5+.
What are the key properties of (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine?
(2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine has a molecular weight of 143.23 g/mol, XLogP of 0.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(dimethylamino)methylimino]-N,N-dimethylethanamine is sourced from PubChem (CID 20673994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).