C21H25NO3 — CID 20674
2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 20674) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 20674 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OCCN1CCCCC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c23-20(25-17-16-22-14-8-3-9-15-22)21(24,18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-2,4-7,10-13,24H,3,8-9,14-17H2 |
| InChIKey | RZWPJFMNFATBEG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |