C21H32O17 — CID 20674352
2-[2-[3-[2-(2-acetyloxyethoxycarbonyloxy)propoxycarbonyloxy]-2-hydroxypropoxy]carbonyloxypropoxycarbonyloxy]ethyl acetate (PubChem CID 20674352) has the molecular formula C21H32O17 and a molecular weight of 556.47 g/mol. Its IUPAC name is 2-[2-[3-[2-(2-acetyloxyethoxycarbonyloxy)propoxycarbonyloxy]-2-hydroxypropoxy]carbonyloxypropoxycarbonyloxy]ethyl acetate.
| Compound Name | 2-[2-[3-[2-(2-acetyloxyethoxycarbonyloxy)propoxycarbonyloxy]-2-hydroxypropoxy]carbonyloxypropoxycarbonyloxy]ethyl acetate |
|---|---|
| PubChem CID | 20674352 |
| Molecular Formula | C21H32O17 |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 2-[2-[3-[2-(2-acetyloxyethoxycarbonyloxy)propoxycarbonyloxy]-2-hydroxypropoxy]carbonyloxypropoxycarbonyloxy]ethyl acetate |
| SMILES | CC(=O)OCCOC(=O)OCC(C)OC(=O)OCC(O)COC(=O)OCC(C)OC(=O)OCCOC(C)=O |
| InChI | InChI=1S/C21H32O17/c1-13(37-20(27)32-8-6-30-16(4)23)10-34-19(26)35-11-17(24)12-36-21(28)38-14(2)9-33-18(25)31-7-5-29-15(3)22/h13-14,17,24H,5-12H2,1-4H3 |
| InChIKey | RVQSSNHVJSUION-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 214.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|