C28H34N4O5 — CID 20674581
tert-butyl N-[3-(4-aminophenyl)-1-[[1-[(4-methoxyphenyl)methyl]-4-methyl-2-oxo-3-pyridinyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 20674581) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is tert-butyl N-[3-(4-aminophenyl)-1-[[1-[(4-methoxyphenyl)methyl]-4-methyl-2-oxo-3-pyridinyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-aminophenyl)-1-[[1-[(4-methoxyphenyl)methyl]-4-methyl-2-oxo-3-pyridinyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 20674581 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | tert-butyl N-[3-(4-aminophenyl)-1-[[1-[(4-methoxyphenyl)methyl]-4-methyl-2-oxo-3-pyridinyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(Cn2ccc(C)c(NC(=O)C(Cc3ccc(N)cc3)NC(=O)OC(C)(C)C)c2=O)cc1 |
| InChI | InChI=1S/C28H34N4O5/c1-18-14-15-32(17-20-8-12-22(36-5)13-9-20)26(34)24(18)31-25(33)23(30-27(35)37-28(2,3)4)16-19-6-10-21(29)11-7-19/h6-15,23H,16-17,29H2,1-5H3,(H,30,35)(H,31,33) |
| InChIKey | GNJDLHKFKYYTHA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|