C21H26N4O5S — CID 20674782
N-methyl-1-(4-nitrophenyl)sulfonyl-N-(3-pyridin-3-ylpropyl)piperidine-2-carboxamide (PubChem CID 20674782) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-methyl-1-(4-nitrophenyl)sulfonyl-N-(3-pyridin-3-ylpropyl)piperidine-2-carboxamide.
| Compound Name | N-methyl-1-(4-nitrophenyl)sulfonyl-N-(3-pyridin-3-ylpropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 20674782 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-methyl-1-(4-nitrophenyl)sulfonyl-N-(3-pyridin-3-ylpropyl)piperidine-2-carboxamide |
| SMILES | CN(CCCc1cccnc1)C(=O)C1CCCCN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H26N4O5S/c1-23(14-5-7-17-6-4-13-22-16-17)21(26)20-8-2-3-15-24(20)31(29,30)19-11-9-18(10-12-19)25(27)28/h4,6,9-13,16,20H,2-3,5,7-8,14-15H2,1H3 |
| InChIKey | OUIYSNANZXHTNN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|