C22H36NO+ — CID 20674979
dicyclohexyl-methyl-[2-(3-methylphenoxy)ethyl]azanium (PubChem CID 20674979) has the molecular formula C22H36NO+ and a molecular weight of 330.54 g/mol. Its IUPAC name is dicyclohexyl-methyl-[2-(3-methylphenoxy)ethyl]azanium.
| Compound Name | dicyclohexyl-methyl-[2-(3-methylphenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 20674979 |
| Molecular Formula | C22H36NO+ |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | dicyclohexyl-methyl-[2-(3-methylphenoxy)ethyl]azanium |
| SMILES | Cc1cccc(OCC[N+](C)(C2CCCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H36NO/c1-19-10-9-15-22(18-19)24-17-16-23(2,20-11-5-3-6-12-20)21-13-7-4-8-14-21/h9-10,15,18,20-21H,3-8,11-14,16-17H2,1-2H3/q+1 |
| InChIKey | WRQSGEOJADWGMM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|