About 1-methylpyrrolidine-2,5-diol
1-methylpyrrolidine-2,5-diol (PubChem CID 20675081) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 1-methylpyrrolidine-2,5-diol.
Molecular Properties
| Compound Name | 1-methylpyrrolidine-2,5-diol |
| PubChem CID | 20675081 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 1-methylpyrrolidine-2,5-diol |
| SMILES | CN1C(O)CCC1O |
| InChI | InChI=1S/C5H11NO2/c1-6-4(7)2-3-5(6)8/h4-5,7-8H,2-3H2,1H3 |
| InChIKey | KOYCAZDIFLYARN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpyrrolidine-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidine-2,5-diol?
The IUPAC name of 1-methylpyrrolidine-2,5-diol (CID 20675081) is 1-methylpyrrolidine-2,5-diol.
What is the SMILES notation for 1-methylpyrrolidine-2,5-diol?
The canonical SMILES for 1-methylpyrrolidine-2,5-diol is CN1C(O)CCC1O.
What is the InChIKey of 1-methylpyrrolidine-2,5-diol?
The InChIKey is KOYCAZDIFLYARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-6-4(7)2-3-5(6)8/h4-5,7-8H,2-3H2,1H3.
What are the key properties of 1-methylpyrrolidine-2,5-diol?
1-methylpyrrolidine-2,5-diol has a molecular weight of 117.15 g/mol, XLogP of -0.65, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidine-2,5-diol is sourced from PubChem (CID 20675081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).