About N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine
N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine (PubChem CID 20675200) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine |
| PubChem CID | 20675200 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine |
| SMILES | CN(C)C1=CCC2C=CC=CC12 |
| InChI | InChI=1S/C11H15N/c1-12(2)11-8-7-9-5-3-4-6-10(9)11/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | OPNXKKBXOFRPEJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine?
The IUPAC name of N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine (CID 20675200) is N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine.
What is the SMILES notation for N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine?
The canonical SMILES for N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine is CN(C)C1=CCC2C=CC=CC12.
What is the InChIKey of N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine?
The InChIKey is OPNXKKBXOFRPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-12(2)11-8-7-9-5-3-4-6-10(9)11/h3-6,8-10H,7H2,1-2H3.
What are the key properties of N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine?
N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine has a molecular weight of 161.25 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3a,7a-dihydro-3H-inden-1-amine is sourced from PubChem (CID 20675200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).