About 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol
1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol (PubChem CID 20675295) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol.
Molecular Properties
| Compound Name | 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol |
| PubChem CID | 20675295 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol |
| SMILES | OCC12COC(CO1)C2O |
| InChI | InChI=1S/C6H10O4/c7-2-6-3-9-4(1-10-6)5(6)8/h4-5,7-8H,1-3H2 |
| InChIKey | XSACIPXSUWEZCP-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol?
The IUPAC name of 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol (CID 20675295) is 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol.
What is the SMILES notation for 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol?
The canonical SMILES for 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol is OCC12COC(CO1)C2O.
What is the InChIKey of 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol?
The InChIKey is XSACIPXSUWEZCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c7-2-6-3-9-4(1-10-6)5(6)8/h4-5,7-8H,1-3H2.
What are the key properties of 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol?
1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol has a molecular weight of 146.14 g/mol, XLogP of -1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-7-ol is sourced from PubChem (CID 20675295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).