C15H14N2O6 — CID 2067554
ethyl 2-[4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate (PubChem CID 2067554) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is ethyl 2-[4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2067554 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | ethyl 2-[4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C15H14N2O6/c1-2-22-12(18)8-23-10-5-3-9(4-6-10)7-11-13(19)16-15(21)17-14(11)20/h3-7H,2,8H2,1H3,(H2,16,17,19,20,21) |
| InChIKey | AIMJUAHUJJJEAW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|