C10H3Br2F9O4S — CID 20675566
3,4-bis(2-bromo-1,1,2,2-tetrafluoroethoxy)benzenesulfonyl fluoride (PubChem CID 20675566) has the molecular formula C10H3Br2F9O4S and a molecular weight of 549.99 g/mol. Its IUPAC name is 3,4-bis(2-bromo-1,1,2,2-tetrafluoroethoxy)benzenesulfonyl fluoride.
| Compound Name | 3,4-bis(2-bromo-1,1,2,2-tetrafluoroethoxy)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 20675566 |
| Molecular Formula | C10H3Br2F9O4S |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 547.80 |
| IUPAC Name | 3,4-bis(2-bromo-1,1,2,2-tetrafluoroethoxy)benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc(OC(F)(F)C(F)(F)Br)c(OC(F)(F)C(F)(F)Br)c1 |
| InChI | InChI=1S/C10H3Br2F9O4S/c11-7(13,14)9(17,18)24-5-2-1-4(26(21,22)23)3-6(5)25-10(19,20)8(12,15)16/h1-3H |
| InChIKey | IBYHMZJFNLHZJF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|