C15H30O2 — CID 20675641
6-tert-butyl-4-methoxy-2,3,3,4,5-pentamethyloxane (PubChem CID 20675641) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 6-tert-butyl-4-methoxy-2,3,3,4,5-pentamethyloxane.
| Compound Name | 6-tert-butyl-4-methoxy-2,3,3,4,5-pentamethyloxane |
|---|---|
| PubChem CID | 20675641 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 6-tert-butyl-4-methoxy-2,3,3,4,5-pentamethyloxane |
| SMILES | COC1(C)C(C)C(C(C)(C)C)OC(C)C1(C)C |
| InChI | InChI=1S/C15H30O2/c1-10-12(13(3,4)5)17-11(2)14(6,7)15(10,8)16-9/h10-12H,1-9H3 |
| InChIKey | JNZUKTJTMUGDRM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |