C12H26N4 — CID 20675647
1,2,3,6,7,8,9-heptamethyl-4,5,6,8-tetrahydro-2H-purine (PubChem CID 20675647) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is 1,2,3,6,7,8,9-heptamethyl-4,5,6,8-tetrahydro-2H-purine.
| Compound Name | 1,2,3,6,7,8,9-heptamethyl-4,5,6,8-tetrahydro-2H-purine |
|---|---|
| PubChem CID | 20675647 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 1,2,3,6,7,8,9-heptamethyl-4,5,6,8-tetrahydro-2H-purine |
| SMILES | CC1C2C(N(C)C(C)N1C)N(C)C(C)N2C |
| InChI | InChI=1S/C12H26N4/c1-8-11-12(15(6)9(2)13(8)4)16(7)10(3)14(11)5/h8-12H,1-7H3 |
| InChIKey | XZNFKCDCIQBXTK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |