C34H54O7 — CID 20675715
1-O-tert-butyl 5-O-(2-methyl-2-adamantyl) 3-O-(3-oxocyclohexyl) 1,3,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 20675715) has the molecular formula C34H54O7 and a molecular weight of 574.80 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2-methyl-2-adamantyl) 3-O-(3-oxocyclohexyl) 1,3,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-(2-methyl-2-adamantyl) 3-O-(3-oxocyclohexyl) 1,3,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20675715 |
| Molecular Formula | C34H54O7 |
| Molecular Weight | 574.80 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2-methyl-2-adamantyl) 3-O-(3-oxocyclohexyl) 1,3,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)C(=O)OC(C)(C)C)C(=O)OC1CCCC(=O)C1)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C34H54O7/c1-9-32(6,30(38)41-34(8)24-14-22-13-23(16-24)17-25(34)15-22)20-33(7,19-21(2)28(36)40-31(3,4)5)29(37)39-27-12-10-11-26(35)18-27/h21-25,27H,9-20H2,1-8H3 |
| InChIKey | ACEAXCXRFXOXAC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.80 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|