C26H38O6 — CID 20675719
1-O-(4-methyl-2-oxooxan-4-yl) 5-O-(10-tricyclo[5.2.1.02,6]dec-3-enyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 20675719) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 1-O-(4-methyl-2-oxooxan-4-yl) 5-O-(10-tricyclo[5.2.1.02,6]dec-3-enyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(4-methyl-2-oxooxan-4-yl) 5-O-(10-tricyclo[5.2.1.02,6]dec-3-enyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 20675719 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 1-O-(4-methyl-2-oxooxan-4-yl) 5-O-(10-tricyclo[5.2.1.02,6]dec-3-enyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC1(C)CCOC(=O)C1)C(=O)OC1C2CCC1C1CC=CC12 |
| InChI | InChI=1S/C26H38O6/c1-6-25(4,15-24(2,3)22(28)32-26(5)12-13-30-20(27)14-26)23(29)31-21-18-10-11-19(21)17-9-7-8-16(17)18/h7-8,16-19,21H,6,9-15H2,1-5H3 |
| InChIKey | GCUWUFXOQPQBPL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|