C15H19N — CID 20675919
1,1,2,3,3-pentamethyl-2H-indene-4-carbonitrile (PubChem CID 20675919) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 1,1,2,3,3-pentamethyl-2H-indene-4-carbonitrile.
| Compound Name | 1,1,2,3,3-pentamethyl-2H-indene-4-carbonitrile |
|---|---|
| PubChem CID | 20675919 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1,1,2,3,3-pentamethyl-2H-indene-4-carbonitrile |
| SMILES | CC1C(C)(C)c2cccc(C#N)c2C1(C)C |
| InChI | InChI=1S/C15H19N/c1-10-14(2,3)12-8-6-7-11(9-16)13(12)15(10,4)5/h6-8,10H,1-5H3 |
| InChIKey | CPCVZHLUXPMTJZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |