About 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide
2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide (PubChem CID 20676097) has the molecular formula C9H19N3O+2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
| PubChem CID | 20676097 |
| Molecular Formula | C9H19N3O+2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
| SMILES | C[N+]12CC[N+](CC(N)=O)(CC1)CC2 |
| InChI | InChI=1S/C9H18N3O/c1-11-2-5-12(6-3-11,7-4-11)8-9(10)13/h2-8H2,1H3,(H-,10,13)/q+1/p+1 |
| InChIKey | CKJJSSSJRPNCCK-UHFFFAOYSA-O |
| XLogP | -1.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide?
The IUPAC name of 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide (CID 20676097) is 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide.
What is the SMILES notation for 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide?
The canonical SMILES for 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide is C[N+]12CC[N+](CC(N)=O)(CC1)CC2.
What is the InChIKey of 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide?
The InChIKey is CKJJSSSJRPNCCK-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H18N3O/c1-11-2-5-12(6-3-11,7-4-11)8-9(10)13/h2-8H2,1H3,(H-,10,13)/q+1/p+1.
What are the key properties of 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide?
2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide has a molecular weight of 185.27 g/mol, XLogP of -1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide is sourced from PubChem (CID 20676097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).